About 2-(2,4-dimethoxyphenyl)-1,3-oxazolidine
2-(2,4-dimethoxyphenyl)-1,3-oxazolidine (PubChem CID 3056415) has the molecular formula C11H15NO3
and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-(2,4-dimethoxyphenyl)-1,3-oxazolidine |
| PubChem CID | 3056415 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-1,3-oxazolidine |
| SMILES | COc1ccc(C2NCCO2)c(OC)c1 |
| InChI | InChI=1S/C11H15NO3/c1-13-8-3-4-9(10(7-8)14-2)11-12-5-6-15-11/h3-4,7,11-12H,5-6H2,1-2H3 |
| InChIKey | ZUGRHGYRHBYRCK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,4-dimethoxyphenyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethoxyphenyl)-1,3-oxazolidine?
The IUPAC name of 2-(2,4-dimethoxyphenyl)-1,3-oxazolidine (CID 3056415) is 2-(2,4-dimethoxyphenyl)-1,3-oxazolidine.
What is the SMILES notation for 2-(2,4-dimethoxyphenyl)-1,3-oxazolidine?
The canonical SMILES for 2-(2,4-dimethoxyphenyl)-1,3-oxazolidine is COc1ccc(C2NCCO2)c(OC)c1.
What is the InChIKey of 2-(2,4-dimethoxyphenyl)-1,3-oxazolidine?
The InChIKey is ZUGRHGYRHBYRCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3/c1-13-8-3-4-9(10(7-8)14-2)11-12-5-6-15-11/h3-4,7,11-12H,5-6H2,1-2H3.
What are the key properties of 2-(2,4-dimethoxyphenyl)-1,3-oxazolidine?
2-(2,4-dimethoxyphenyl)-1,3-oxazolidine has a molecular weight of 209.25 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethoxyphenyl)-1,3-oxazolidine is sourced from PubChem (CID 3056415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).