About 3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride
3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride (PubChem CID 3056418) has the molecular formula C13H20ClNO
and a molecular weight of 241.76 g/mol. Its IUPAC name is 3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride.
Molecular Properties
| Compound Name | 3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride |
| PubChem CID | 3056418 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride |
| SMILES | CCCC(c1ccccc1)N1CCOC1.Cl |
| InChI | InChI=1S/C13H19NO.ClH/c1-2-6-13(14-9-10-15-11-14)12-7-4-3-5-8-12;/h3-5,7-8,13H,2,6,9-11H2,1H3;1H |
| InChIKey | COYALERAORPIMK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride?
The IUPAC name of 3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride (CID 3056418) is 3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride.
What is the SMILES notation for 3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride?
The canonical SMILES for 3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride is CCCC(c1ccccc1)N1CCOC1.Cl.
What is the InChIKey of 3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride?
The InChIKey is COYALERAORPIMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO.ClH/c1-2-6-13(14-9-10-15-11-14)12-7-4-3-5-8-12;/h3-5,7-8,13H,2,6,9-11H2,1H3;1H.
What are the key properties of 3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride?
3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride has a molecular weight of 241.76 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-phenylbutyl)-1,3-oxazolidine;hydrochloride is sourced from PubChem (CID 3056418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).