About (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide
(1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide (PubChem CID 3056703) has the molecular formula C17H27BrN2O2
and a molecular weight of 371.32 g/mol. Its IUPAC name is (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide.
Molecular Properties
| Compound Name | (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide |
| PubChem CID | 3056703 |
| Molecular Formula | C17H27BrN2O2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide |
| SMILES | Br.CCNC(=O)OC(CCN1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C17H26N2O2.BrH/c1-2-18-17(20)21-16(15-9-5-3-6-10-15)11-14-19-12-7-4-8-13-19;/h3,5-6,9-10,16H,2,4,7-8,11-14H2,1H3,(H,18,20);1H |
| InChIKey | XYKLSUCHTAEKLJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide?
The IUPAC name of (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide (CID 3056703) is (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide.
What is the SMILES notation for (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide?
The canonical SMILES for (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide is Br.CCNC(=O)OC(CCN1CCCCC1)c1ccccc1.
What is the InChIKey of (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide?
The InChIKey is XYKLSUCHTAEKLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2.BrH/c1-2-18-17(20)21-16(15-9-5-3-6-10-15)11-14-19-12-7-4-8-13-19;/h3,5-6,9-10,16H,2,4,7-8,11-14H2,1H3,(H,18,20);1H.
What are the key properties of (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide?
(1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide has a molecular weight of 371.32 g/mol, XLogP of 3.93, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate;hydrobromide is sourced from PubChem (CID 3056703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).