C17H26N2O2 — CID 3056704
(1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate (PubChem CID 3056704) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate.
| Compound Name | (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate |
|---|---|
| PubChem CID | 3056704 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (1-phenyl-3-piperidin-1-ylpropyl) N-ethylcarbamate |
| SMILES | CCNC(=O)OC(CCN1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C17H26N2O2/c1-2-18-17(20)21-16(15-9-5-3-6-10-15)11-14-19-12-7-4-8-13-19/h3,5-6,9-10,16H,2,4,7-8,11-14H2,1H3,(H,18,20) |
| InChIKey | SSIXYBBQXJIUNE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |