C10H14BrN3O3S — CID 3056806
(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)methyl carbamimidothioate;hydrobromide (PubChem CID 3056806) has the molecular formula C10H14BrN3O3S and a molecular weight of 336.21 g/mol. Its IUPAC name is (1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)methyl carbamimidothioate;hydrobromide.
| Compound Name | (1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)methyl carbamimidothioate;hydrobromide |
|---|---|
| PubChem CID | 3056806 |
| Molecular Formula | C10H14BrN3O3S |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | (1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)methyl carbamimidothioate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SCN1C(=O)C2C3CCC(O3)C2C1=O |
| InChI | InChI=1S/C10H13N3O3S.BrH/c11-10(12)17-3-13-8(14)6-4-1-2-5(16-4)7(6)9(13)15;/h4-7H,1-3H2,(H3,11,12);1H |
| InChIKey | YCSKSOXKJPEURC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|