About 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium
1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium (PubChem CID 3056867) has the molecular formula C9H16N+
and a molecular weight of 138.23 g/mol. Its IUPAC name is 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium.
Molecular Properties
| Compound Name | 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium |
| PubChem CID | 3056867 |
| Molecular Formula | C9H16N+ |
| Molecular Weight | 138.23 g/mol |
| Exact Mass | 138.13 |
| IUPAC Name | 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium |
| SMILES | C=CC[N+]1(C)CC=CCC1 |
| InChI | InChI=1S/C9H16N/c1-3-7-10(2)8-5-4-6-9-10/h3-5H,1,6-9H2,2H3/q+1 |
| InChIKey | ONGBZQAGLDSGAT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium?
The IUPAC name of 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium (CID 3056867) is 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium.
What is the SMILES notation for 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium?
The canonical SMILES for 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium is C=CC[N+]1(C)CC=CCC1.
What is the InChIKey of 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium?
The InChIKey is ONGBZQAGLDSGAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N/c1-3-7-10(2)8-5-4-6-9-10/h3-5H,1,6-9H2,2H3/q+1.
What are the key properties of 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium?
1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium has a molecular weight of 138.23 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium is sourced from PubChem (CID 3056867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).