C12H16N2O5 — CID 3056911
1-quinoxalin-2-ylbutane-1,2,3,4-tetrol;hydrate (PubChem CID 3056911) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-quinoxalin-2-ylbutane-1,2,3,4-tetrol;hydrate.
| Compound Name | 1-quinoxalin-2-ylbutane-1,2,3,4-tetrol;hydrate |
|---|---|
| PubChem CID | 3056911 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-quinoxalin-2-ylbutane-1,2,3,4-tetrol;hydrate |
| SMILES | O.OCC(O)C(O)C(O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C12H14N2O4.H2O/c15-6-10(16)12(18)11(17)9-5-13-7-3-1-2-4-8(7)14-9;/h1-5,10-12,15-18H,6H2;1H2 |
| InChIKey | PKXYFVIRFYZKDQ-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |