About (4-phenoxyphenyl)methyl thiocyanate
(4-phenoxyphenyl)methyl thiocyanate (PubChem CID 3056931) has the molecular formula C14H11NOS
and a molecular weight of 241.31 g/mol. Its IUPAC name is (4-phenoxyphenyl)methyl thiocyanate.
Molecular Properties
| Compound Name | (4-phenoxyphenyl)methyl thiocyanate |
| PubChem CID | 3056931 |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (4-phenoxyphenyl)methyl thiocyanate |
| SMILES | N#CSCc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C14H11NOS/c15-11-17-10-12-6-8-14(9-7-12)16-13-4-2-1-3-5-13/h1-9H,10H2 |
| InChIKey | HZWXKVPCNDGWFA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (4-phenoxyphenyl)methyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenoxyphenyl)methyl thiocyanate?
The IUPAC name of (4-phenoxyphenyl)methyl thiocyanate (CID 3056931) is (4-phenoxyphenyl)methyl thiocyanate.
What is the SMILES notation for (4-phenoxyphenyl)methyl thiocyanate?
The canonical SMILES for (4-phenoxyphenyl)methyl thiocyanate is N#CSCc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of (4-phenoxyphenyl)methyl thiocyanate?
The InChIKey is HZWXKVPCNDGWFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NOS/c15-11-17-10-12-6-8-14(9-7-12)16-13-4-2-1-3-5-13/h1-9H,10H2.
What are the key properties of (4-phenoxyphenyl)methyl thiocyanate?
(4-phenoxyphenyl)methyl thiocyanate has a molecular weight of 241.31 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenoxyphenyl)methyl thiocyanate is sourced from PubChem (CID 3056931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).