About S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate
S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate (PubChem CID 3056964) has the molecular formula C7H9NO3S
and a molecular weight of 187.22 g/mol. Its IUPAC name is S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate.
Molecular Properties
| Compound Name | S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate |
| PubChem CID | 3056964 |
| Molecular Formula | C7H9NO3S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C7H9NO3S/c1-4(9)12-5-3-6(10)8(2)7(5)11/h5H,3H2,1-2H3 |
| InChIKey | RMYKCFYDSCXUPJ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate?
The IUPAC name of S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate (CID 3056964) is S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate.
What is the SMILES notation for S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate?
The canonical SMILES for S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate is CC(=O)SC1CC(=O)N(C)C1=O.
What is the InChIKey of S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate?
The InChIKey is RMYKCFYDSCXUPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S/c1-4(9)12-5-3-6(10)8(2)7(5)11/h5H,3H2,1-2H3.
What are the key properties of S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate?
S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate has a molecular weight of 187.22 g/mol, XLogP of 0.02, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(1-methyl-2,5-dioxopyrrolidin-3-yl) ethanethioate is sourced from PubChem (CID 3056964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).