C11H9N5O — CID 3057067
6-(1-benzofuran-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 3057067) has the molecular formula C11H9N5O and a molecular weight of 227.23 g/mol. Its IUPAC name is 6-(1-benzofuran-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1-benzofuran-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3057067 |
| Molecular Formula | C11H9N5O |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 6-(1-benzofuran-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2cc3ccccc3o2)n1 |
| InChI | InChI=1S/C11H9N5O/c12-10-14-9(15-11(13)16-10)8-5-6-3-1-2-4-7(6)17-8/h1-5H,(H4,12,13,14,15,16) |
| InChIKey | OAYWFCWKRUCHBD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |