About N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine
N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine (PubChem CID 3057293) has the molecular formula C15H25N2S+
and a molecular weight of 265.45 g/mol. Its IUPAC name is N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine.
Molecular Properties
| Compound Name | N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine |
| PubChem CID | 3057293 |
| Molecular Formula | C15H25N2S+ |
| Molecular Weight | 265.45 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine |
| SMILES | c1sc[n+](C2CCCCC2)c1NC1CCCCC1 |
| InChI | InChI=1S/C15H25N2S/c1-3-7-13(8-4-1)16-15-11-18-12-17(15)14-9-5-2-6-10-14/h11-14,16H,1-10H2/q+1 |
| InChIKey | JRHDXLPRFWPTAN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine?
The IUPAC name of N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine (CID 3057293) is N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine.
What is the SMILES notation for N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine?
The canonical SMILES for N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine is c1sc[n+](C2CCCCC2)c1NC1CCCCC1.
What is the InChIKey of N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine?
The InChIKey is JRHDXLPRFWPTAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N2S/c1-3-7-13(8-4-1)16-15-11-18-12-17(15)14-9-5-2-6-10-14/h11-14,16H,1-10H2/q+1.
What are the key properties of N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine?
N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine has a molecular weight of 265.45 g/mol, XLogP of 4.29, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dicyclohexyl-1,3-thiazol-3-ium-4-amine is sourced from PubChem (CID 3057293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).