C18H35NO4S — CID 3057429
2,5-dimethylhexan-1-amine;[(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid (PubChem CID 3057429) has the molecular formula C18H35NO4S and a molecular weight of 361.55 g/mol. Its IUPAC name is 2,5-dimethylhexan-1-amine;[(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid.
| Compound Name | 2,5-dimethylhexan-1-amine;[(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
|---|---|
| PubChem CID | 3057429 |
| Molecular Formula | C18H35NO4S |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 2,5-dimethylhexan-1-amine;[(1S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| SMILES | CC(C)CCC(C)CN.CC1(C)C2CC[C@@]1(CS(=O)(=O)O)C(=O)C2 |
| InChI | InChI=1S/C10H16O4S.C8H19N/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;1-7(2)4-5-8(3)6-9/h7H,3-6H2,1-2H3,(H,12,13,14);7-8H,4-6,9H2,1-3H3/t7?,10-;/m1./s1 |
| InChIKey | JUXLPLCWVQCIBQ-DLGLCQKISA-N |
| XLogP | 3.29 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|