About 8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide
8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide (PubChem CID 3057566) has the molecular formula C8H14BrNO
and a molecular weight of 220.11 g/mol. Its IUPAC name is 8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide.
Molecular Properties
| Compound Name | 8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide |
| PubChem CID | 3057566 |
| Molecular Formula | C8H14BrNO |
| Molecular Weight | 220.11 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide |
| SMILES | Br.CN1C2CCC1CC(=O)C2 |
| InChI | InChI=1S/C8H13NO.BrH/c1-9-6-2-3-7(9)5-8(10)4-6;/h6-7H,2-5H2,1H3;1H |
| InChIKey | NFIYUASUOPYSJQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.11 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide?
The IUPAC name of 8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide (CID 3057566) is 8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide.
What is the SMILES notation for 8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide?
The canonical SMILES for 8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide is Br.CN1C2CCC1CC(=O)C2.
What is the InChIKey of 8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide?
The InChIKey is NFIYUASUOPYSJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO.BrH/c1-9-6-2-3-7(9)5-8(10)4-6;/h6-7H,2-5H2,1H3;1H.
What are the key properties of 8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide?
8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide has a molecular weight of 220.11 g/mol, XLogP of 1.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-8-azabicyclo[3.2.1]octan-3-one;hydrobromide is sourced from PubChem (CID 3057566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).