C19H38N3+3 — CID 3057595
2-methyl-2-[3-(1,4,4-trimethylpiperazine-1,4-diium-1-yl)propyl]-1,3,3a,4,7,7a-hexahydroisoindol-2-ium (PubChem CID 3057595) has the molecular formula C19H38N3+3 and a molecular weight of 308.53 g/mol. Its IUPAC name is 2-methyl-2-[3-(1,4,4-trimethylpiperazine-1,4-diium-1-yl)propyl]-1,3,3a,4,7,7a-hexahydroisoindol-2-ium.
| Compound Name | 2-methyl-2-[3-(1,4,4-trimethylpiperazine-1,4-diium-1-yl)propyl]-1,3,3a,4,7,7a-hexahydroisoindol-2-ium |
|---|---|
| PubChem CID | 3057595 |
| Molecular Formula | C19H38N3+3 |
| Molecular Weight | 308.53 g/mol |
| Exact Mass | 308.30 |
| IUPAC Name | 2-methyl-2-[3-(1,4,4-trimethylpiperazine-1,4-diium-1-yl)propyl]-1,3,3a,4,7,7a-hexahydroisoindol-2-ium |
| SMILES | C[N+]1(C)CC[N+](C)(CCC[N+]2(C)CC3CC=CCC3C2)CC1 |
| InChI | InChI=1S/C19H38N3/c1-20(2)12-14-21(3,15-13-20)10-7-11-22(4)16-18-8-5-6-9-19(18)17-22/h5-6,18-19H,7-17H2,1-4H3/q+3 |
| InChIKey | HQBORUXHHOTBEM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|