About 5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline
5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline (PubChem CID 3057679) has the molecular formula C15H16N2OS
and a molecular weight of 272.37 g/mol. Its IUPAC name is 5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline.
Molecular Properties
| Compound Name | 5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline |
| PubChem CID | 3057679 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline |
| SMILES | CCCCOc1nc2sc(C)nc2c2ccccc12 |
| InChI | InChI=1S/C15H16N2OS/c1-3-4-9-18-14-12-8-6-5-7-11(12)13-15(17-14)19-10(2)16-13/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | ZNSYXEKTZMCOEU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline?
The IUPAC name of 5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline (CID 3057679) is 5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline.
What is the SMILES notation for 5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline?
The canonical SMILES for 5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline is CCCCOc1nc2sc(C)nc2c2ccccc12.
What is the InChIKey of 5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline?
The InChIKey is ZNSYXEKTZMCOEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2OS/c1-3-4-9-18-14-12-8-6-5-7-11(12)13-15(17-14)19-10(2)16-13/h5-8H,3-4,9H2,1-2H3.
What are the key properties of 5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline?
5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline has a molecular weight of 272.37 g/mol, XLogP of 4.33, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxy-2-methyl-[1,3]thiazolo[5,4-c]isoquinoline is sourced from PubChem (CID 3057679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).