C25H33ClN4O2 — CID 30577313
5-chloro-2-methoxy-N-[(2R)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-(4-methylpiperazin-1-yl)ethyl]benzamide (PubChem CID 30577313) has the molecular formula C25H33ClN4O2 and a molecular weight of 457.02 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[(2R)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-(4-methylpiperazin-1-yl)ethyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[(2R)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-(4-methylpiperazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 30577313 |
| Molecular Formula | C25H33ClN4O2 |
| Molecular Weight | 457.02 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 5-chloro-2-methoxy-N-[(2R)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-(4-methylpiperazin-1-yl)ethyl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NC[C@@H](c1ccc2c(c1)CCCN2C)N1CCN(C)CC1 |
| InChI | InChI=1S/C25H33ClN4O2/c1-28-11-13-30(14-12-28)23(19-6-8-22-18(15-19)5-4-10-29(22)2)17-27-25(31)21-16-20(26)7-9-24(21)32-3/h6-9,15-16,23H,4-5,10-14,17H2,1-3H3,(H,27,31)/t23-/m0/s1 |
| InChIKey | ORNACLMLSVHBBQ-QHCPKHFHSA-N |
| XLogP | 3.45 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.02 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|