C8H15N — CID 3057779
2-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole (PubChem CID 3057779) has the molecular formula C8H15N and a molecular weight of 125.22 g/mol. Its IUPAC name is 2-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole.
| Compound Name | 2-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole |
|---|---|
| PubChem CID | 3057779 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.22 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 2-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole |
| SMILES | CC1CC2CCCC2N1 |
| InChI | InChI=1S/C8H15N/c1-6-5-7-3-2-4-8(7)9-6/h6-9H,2-5H2,1H3 |
| InChIKey | PCLLYADXFXPXMU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |