C19H26N2O2 — CID 3057875
1'-[4-(dimethylamino)butyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione (PubChem CID 3057875) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 1'-[4-(dimethylamino)butyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione.
| Compound Name | 1'-[4-(dimethylamino)butyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione |
|---|---|
| PubChem CID | 3057875 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1'-[4-(dimethylamino)butyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione |
| SMILES | CN(C)CCCCN1C(=O)CC2(CCCc3ccccc32)C1=O |
| InChI | InChI=1S/C19H26N2O2/c1-20(2)12-5-6-13-21-17(22)14-19(18(21)23)11-7-9-15-8-3-4-10-16(15)19/h3-4,8,10H,5-7,9,11-14H2,1-2H3 |
| InChIKey | LYVWFWOKUUHFJT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|