C21H29ClN2O2 — CID 3057878
1'-(4-pyrrolidin-1-ylbutyl)spiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione;hydrochloride (PubChem CID 3057878) has the molecular formula C21H29ClN2O2 and a molecular weight of 376.93 g/mol. Its IUPAC name is 1'-(4-pyrrolidin-1-ylbutyl)spiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione;hydrochloride.
| Compound Name | 1'-(4-pyrrolidin-1-ylbutyl)spiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione;hydrochloride |
|---|---|
| PubChem CID | 3057878 |
| Molecular Formula | C21H29ClN2O2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1'-(4-pyrrolidin-1-ylbutyl)spiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione;hydrochloride |
| SMILES | Cl.O=C1CC2(CCCc3ccccc32)C(=O)N1CCCCN1CCCC1 |
| InChI | InChI=1S/C21H28N2O2.ClH/c24-19-16-21(11-7-9-17-8-1-2-10-18(17)21)20(25)23(19)15-6-5-14-22-12-3-4-13-22;/h1-2,8,10H,3-7,9,11-16H2;1H |
| InChIKey | RMVOZJZRRMZWLH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|