About 1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride
1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride (PubChem CID 3057903) has the molecular formula C19H29ClN2O2
and a molecular weight of 352.91 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride.
Molecular Properties
| Compound Name | 1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride |
| PubChem CID | 3057903 |
| Molecular Formula | C19H29ClN2O2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride |
| SMILES | CCN(CC)CCCCCN1C(=O)CC(c2ccccc2)C1=O.Cl |
| InChI | InChI=1S/C19H28N2O2.ClH/c1-3-20(4-2)13-9-6-10-14-21-18(22)15-17(19(21)23)16-11-7-5-8-12-16;/h5,7-8,11-12,17H,3-4,6,9-10,13-15H2,1-2H3;1H |
| InChIKey | NYINCURWMKTQLQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride?
The IUPAC name of 1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride (CID 3057903) is 1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride.
What is the SMILES notation for 1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride?
The canonical SMILES for 1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride is CCN(CC)CCCCCN1C(=O)CC(c2ccccc2)C1=O.Cl.
What is the InChIKey of 1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride?
The InChIKey is NYINCURWMKTQLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O2.ClH/c1-3-20(4-2)13-9-6-10-14-21-18(22)15-17(19(21)23)16-11-7-5-8-12-16;/h5,7-8,11-12,17H,3-4,6,9-10,13-15H2,1-2H3;1H.
What are the key properties of 1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride?
1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride has a molecular weight of 352.91 g/mol, XLogP of 3.46, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(diethylamino)pentyl]-3-phenylpyrrolidine-2,5-dione;hydrochloride is sourced from PubChem (CID 3057903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).