About 1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide
1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide (PubChem CID 3057960) has the molecular formula C13H21BrN2
and a molecular weight of 285.23 g/mol. Its IUPAC name is 1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide.
Molecular Properties
| Compound Name | 1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide |
| PubChem CID | 3057960 |
| Molecular Formula | C13H21BrN2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide |
| SMILES | Br.Cc1cc(C)n(/C=C2/NC(C)CC2C)c1 |
| InChI | InChI=1S/C13H20N2.BrH/c1-9-5-12(4)15(7-9)8-13-10(2)6-11(3)14-13;/h5,7-8,10-11,14H,6H2,1-4H3;1H/b13-8+; |
| InChIKey | QFIMBERFSKZDGL-FNXZNAJJSA-N |
| XLogP | 3.50 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide?
The IUPAC name of 1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide (CID 3057960) is 1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide.
What is the SMILES notation for 1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide?
The canonical SMILES for 1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide is Br.Cc1cc(C)n(/C=C2/NC(C)CC2C)c1.
What is the InChIKey of 1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide?
The InChIKey is QFIMBERFSKZDGL-FNXZNAJJSA-N. The full InChI is InChI=1S/C13H20N2.BrH/c1-9-5-12(4)15(7-9)8-13-10(2)6-11(3)14-13;/h5,7-8,10-11,14H,6H2,1-4H3;1H/b13-8+;.
What are the key properties of 1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide?
1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide has a molecular weight of 285.23 g/mol, XLogP of 3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-(3,5-dimethylpyrrolidin-2-ylidene)methyl]-2,4-dimethylpyrrole;hydrobromide is sourced from PubChem (CID 3057960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).