About (5-methylpyridazino[4,5-b]indol-4-yl)hydrazine
(5-methylpyridazino[4,5-b]indol-4-yl)hydrazine (PubChem CID 3058009) has the molecular formula C11H11N5
and a molecular weight of 213.24 g/mol. Its IUPAC name is (5-methylpyridazino[4,5-b]indol-4-yl)hydrazine.
Molecular Properties
| Compound Name | (5-methylpyridazino[4,5-b]indol-4-yl)hydrazine |
| PubChem CID | 3058009 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | (5-methylpyridazino[4,5-b]indol-4-yl)hydrazine |
| SMILES | Cn1c2ccccc2c2cnnc(NN)c21 |
| InChI | InChI=1S/C11H11N5/c1-16-9-5-3-2-4-7(9)8-6-13-15-11(14-12)10(8)16/h2-6H,12H2,1H3,(H,14,15) |
| InChIKey | RRWRASAPJBKWFV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-methylpyridazino[4,5-b]indol-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methylpyridazino[4,5-b]indol-4-yl)hydrazine?
The IUPAC name of (5-methylpyridazino[4,5-b]indol-4-yl)hydrazine (CID 3058009) is (5-methylpyridazino[4,5-b]indol-4-yl)hydrazine.
What is the SMILES notation for (5-methylpyridazino[4,5-b]indol-4-yl)hydrazine?
The canonical SMILES for (5-methylpyridazino[4,5-b]indol-4-yl)hydrazine is Cn1c2ccccc2c2cnnc(NN)c21.
What is the InChIKey of (5-methylpyridazino[4,5-b]indol-4-yl)hydrazine?
The InChIKey is RRWRASAPJBKWFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5/c1-16-9-5-3-2-4-7(9)8-6-13-15-11(14-12)10(8)16/h2-6H,12H2,1H3,(H,14,15).
What are the key properties of (5-methylpyridazino[4,5-b]indol-4-yl)hydrazine?
(5-methylpyridazino[4,5-b]indol-4-yl)hydrazine has a molecular weight of 213.24 g/mol, XLogP of 1.41, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylpyridazino[4,5-b]indol-4-yl)hydrazine is sourced from PubChem (CID 3058009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).