C20H22N2O4 — CID 30580744
N-[2-[(3S)-3-hydroxypiperidin-1-yl]-2-oxoethyl]-4-phenoxybenzamide (PubChem CID 30580744) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[2-[(3S)-3-hydroxypiperidin-1-yl]-2-oxoethyl]-4-phenoxybenzamide.
| Compound Name | N-[2-[(3S)-3-hydroxypiperidin-1-yl]-2-oxoethyl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 30580744 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-[2-[(3S)-3-hydroxypiperidin-1-yl]-2-oxoethyl]-4-phenoxybenzamide |
| SMILES | O=C(NCC(=O)N1CCC[C@H](O)C1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N2O4/c23-16-5-4-12-22(14-16)19(24)13-21-20(25)15-8-10-18(11-9-15)26-17-6-2-1-3-7-17/h1-3,6-11,16,23H,4-5,12-14H2,(H,21,25)/t16-/m0/s1 |
| InChIKey | DOUSCRKZOUXDTQ-INIZCTEOSA-N |
| XLogP | 2.19 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |