C26H31N3O3S — CID 3058124
3-[(6aR,9S)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-benzyl-2-methylsulfonylpropanamide (PubChem CID 3058124) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is 3-[(6aR,9S)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-benzyl-2-methylsulfonylpropanamide.
| Compound Name | 3-[(6aR,9S)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-benzyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 3058124 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 3-[(6aR,9S)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-benzyl-2-methylsulfonylpropanamide |
| SMILES | CN1C[C@H](CC(C(=O)NCc2ccccc2)S(C)(=O)=O)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C26H31N3O3S/c1-29-16-18(11-21-20-9-6-10-22-25(20)19(15-27-22)13-23(21)29)12-24(33(2,31)32)26(30)28-14-17-7-4-3-5-8-17/h3-10,15,18,21,23-24,27H,11-14,16H2,1-2H3,(H,28,30)/t18-,21?,23+,24?/m0/s1 |
| InChIKey | YEGPEFJMNJZVOR-QZPWXEBDSA-N |
| XLogP | 3.25 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |