About 6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine
6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine (PubChem CID 3058312) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is 6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine |
| PubChem CID | 3058312 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine |
| SMILES | c1nc(N2CCCCC2)cc2c1CCN2 |
| InChI | InChI=1S/C12H17N3/c1-2-6-15(7-3-1)12-8-11-10(9-14-12)4-5-13-11/h8-9,13H,1-7H2 |
| InChIKey | AWGQRZJVOKJYFO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine?
The IUPAC name of 6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine (CID 3058312) is 6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine.
What is the SMILES notation for 6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine?
The canonical SMILES for 6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine is c1nc(N2CCCCC2)cc2c1CCN2.
What is the InChIKey of 6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine?
The InChIKey is AWGQRZJVOKJYFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3/c1-2-6-15(7-3-1)12-8-11-10(9-14-12)4-5-13-11/h8-9,13H,1-7H2.
What are the key properties of 6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine?
6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine has a molecular weight of 203.29 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperidin-1-yl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine is sourced from PubChem (CID 3058312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).