C18H17ClN2S — CID 3058324
9-chloro-7-phenyl-2,4,4a,5-tetrahydro-1H-[1,4]thiazino[4,3-a][1,4]benzodiazepine (PubChem CID 3058324) has the molecular formula C18H17ClN2S and a molecular weight of 328.87 g/mol. Its IUPAC name is 9-chloro-7-phenyl-2,4,4a,5-tetrahydro-1H-[1,4]thiazino[4,3-a][1,4]benzodiazepine.
| Compound Name | 9-chloro-7-phenyl-2,4,4a,5-tetrahydro-1H-[1,4]thiazino[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 3058324 |
| Molecular Formula | C18H17ClN2S |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 9-chloro-7-phenyl-2,4,4a,5-tetrahydro-1H-[1,4]thiazino[4,3-a][1,4]benzodiazepine |
| SMILES | Clc1ccc2c(c1)C(c1ccccc1)=NCC1CSCCN21 |
| InChI | InChI=1S/C18H17ClN2S/c19-14-6-7-17-16(10-14)18(13-4-2-1-3-5-13)20-11-15-12-22-9-8-21(15)17/h1-7,10,15H,8-9,11-12H2 |
| InChIKey | VVEZDSJZWQUMOP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |