C14H19Cl2N3O3 — CID 3058383
(2S)-2-[(4-oxoquinazolin-3-yl)methylamino]pentanoic acid;dihydrochloride (PubChem CID 3058383) has the molecular formula C14H19Cl2N3O3 and a molecular weight of 348.23 g/mol. Its IUPAC name is (2S)-2-[(4-oxoquinazolin-3-yl)methylamino]pentanoic acid;dihydrochloride.
| Compound Name | (2S)-2-[(4-oxoquinazolin-3-yl)methylamino]pentanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 3058383 |
| Molecular Formula | C14H19Cl2N3O3 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (2S)-2-[(4-oxoquinazolin-3-yl)methylamino]pentanoic acid;dihydrochloride |
| SMILES | CCC[C@H](NCn1cnc2ccccc2c1=O)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C14H17N3O3.2ClH/c1-2-5-12(14(19)20)16-9-17-8-15-11-7-4-3-6-10(11)13(17)18;;/h3-4,6-8,12,16H,2,5,9H2,1H3,(H,19,20);2*1H/t12-;;/m0../s1 |
| InChIKey | VRUUUFWFAYXCEL-LTCKWSDVSA-N |
| XLogP | 2.04 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |