About N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride
N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride (PubChem CID 3058428) has the molecular formula C13H11ClN2O2
and a molecular weight of 262.70 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride |
| PubChem CID | 3058428 |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride |
| SMILES | C(=N/c1ccc2c(c1)OCO2)\c1ccncc1.Cl |
| InChI | InChI=1S/C13H10N2O2.ClH/c1-2-12-13(17-9-16-12)7-11(1)15-8-10-3-5-14-6-4-10;/h1-8H,9H2;1H/b15-8+; |
| InChIKey | KVZACMAJFXOBAW-TWNLEINFSA-N |
| XLogP | 2.98 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride?
The IUPAC name of N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride (CID 3058428) is N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride.
What is the SMILES notation for N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride?
The canonical SMILES for N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride is C(=N/c1ccc2c(c1)OCO2)\c1ccncc1.Cl.
What is the InChIKey of N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride?
The InChIKey is KVZACMAJFXOBAW-TWNLEINFSA-N. The full InChI is InChI=1S/C13H10N2O2.ClH/c1-2-12-13(17-9-16-12)7-11(1)15-8-10-3-5-14-6-4-10;/h1-8H,9H2;1H/b15-8+;.
What are the key properties of N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride?
N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride has a molecular weight of 262.70 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-yl)-1-pyridin-4-ylmethanimine;hydrochloride is sourced from PubChem (CID 3058428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).