About 2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride
2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride (PubChem CID 3058621) has the molecular formula C19H23Cl2N3O2
and a molecular weight of 396.32 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride |
| PubChem CID | 3058621 |
| Molecular Formula | C19H23Cl2N3O2 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCCN1CCCCC1)c1cccnc1Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClN3O2.ClH/c20-15-6-8-16(9-7-15)22-18-17(5-4-10-21-18)19(24)25-14-13-23-11-2-1-3-12-23;/h4-10H,1-3,11-14H2,(H,21,22);1H |
| InChIKey | PJGAFJMKWNSHHU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride?
The IUPAC name of 2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride (CID 3058621) is 2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride.
What is the SMILES notation for 2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride?
The canonical SMILES for 2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride is Cl.O=C(OCCN1CCCCC1)c1cccnc1Nc1ccc(Cl)cc1.
What is the InChIKey of 2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride?
The InChIKey is PJGAFJMKWNSHHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22ClN3O2.ClH/c20-15-6-8-16(9-7-15)22-18-17(5-4-10-21-18)19(24)25-14-13-23-11-2-1-3-12-23;/h4-10H,1-3,11-14H2,(H,21,22);1H.
What are the key properties of 2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride?
2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride has a molecular weight of 396.32 g/mol, XLogP of 4.54, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl 2-(4-chloroanilino)pyridine-3-carboxylate;hydrochloride is sourced from PubChem (CID 3058621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).