C10H12N2O — CID 3058692
(4S,5R)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 3058692) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is (4S,5R)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | (4S,5R)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 3058692 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (4S,5R)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | C[C@@H]1N=C(N)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C10H12N2O/c1-7-9(13-10(11)12-7)8-5-3-2-4-6-8/h2-7,9H,1H3,(H2,11,12)/t7-,9-/m0/s1 |
| InChIKey | LJQBMYDFWFGESC-CBAPKCEASA-N |
| XLogP | 1.46 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |