About 6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine
6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine (PubChem CID 3058704) has the molecular formula C17H20N2O
and a molecular weight of 268.36 g/mol. Its IUPAC name is 6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine.
Molecular Properties
| Compound Name | 6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine |
| PubChem CID | 3058704 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine |
| SMILES | c1ccc(OCCCN2CCc3ncccc3C2)cc1 |
| InChI | InChI=1S/C17H20N2O/c1-2-7-16(8-3-1)20-13-5-11-19-12-9-17-15(14-19)6-4-10-18-17/h1-4,6-8,10H,5,9,11-14H2 |
| InChIKey | GVHURPYMTIYADW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine?
The IUPAC name of 6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine (CID 3058704) is 6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine.
What is the SMILES notation for 6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine?
The canonical SMILES for 6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine is c1ccc(OCCCN2CCc3ncccc3C2)cc1.
What is the InChIKey of 6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine?
The InChIKey is GVHURPYMTIYADW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O/c1-2-7-16(8-3-1)20-13-5-11-19-12-9-17-15(14-19)6-4-10-18-17/h1-4,6-8,10H,5,9,11-14H2.
What are the key properties of 6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine?
6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine has a molecular weight of 268.36 g/mol, XLogP of 2.91, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-phenoxypropyl)-7,8-dihydro-5H-1,6-naphthyridine is sourced from PubChem (CID 3058704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).