C13H14N2S — CID 3058730
14-thia-11,16-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,12,15-tetraene (PubChem CID 3058730) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is 14-thia-11,16-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,12,15-tetraene.
| Compound Name | 14-thia-11,16-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,12,15-tetraene |
|---|---|
| PubChem CID | 3058730 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 14-thia-11,16-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,12,15-tetraene |
| SMILES | C1=C2c3nc4sccn4c3CCC2CCC1 |
| InChI | InChI=1S/C13H14N2S/c1-2-4-10-9(3-1)5-6-11-12(10)14-13-15(11)7-8-16-13/h4,7-9H,1-3,5-6H2 |
| InChIKey | DIXMNRFCQHQODK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |