C22H32N2O3 — CID 3058735
1'-[4-(diethylamino)butyl]-6-methoxyspiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione (PubChem CID 3058735) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1'-[4-(diethylamino)butyl]-6-methoxyspiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione.
| Compound Name | 1'-[4-(diethylamino)butyl]-6-methoxyspiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione |
|---|---|
| PubChem CID | 3058735 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 1'-[4-(diethylamino)butyl]-6-methoxyspiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione |
| SMILES | CCN(CC)CCCCN1C(=O)CC2(CCCc3ccc(OC)cc32)C1=O |
| InChI | InChI=1S/C22H32N2O3/c1-4-23(5-2)13-6-7-14-24-20(25)16-22(21(24)26)12-8-9-17-10-11-18(27-3)15-19(17)22/h10-11,15H,4-9,12-14,16H2,1-3H3 |
| InChIKey | IPIQKBIKYLVUPY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|