About 2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine
2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine (PubChem CID 3058776) has the molecular formula C12H23NS
and a molecular weight of 213.39 g/mol. Its IUPAC name is 2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine |
| PubChem CID | 3058776 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine |
| SMILES | CC(C)=CCCC(C)CC1NCCS1 |
| InChI | InChI=1S/C12H23NS/c1-10(2)5-4-6-11(3)9-12-13-7-8-14-12/h5,11-13H,4,6-9H2,1-3H3 |
| InChIKey | OCSCKACVZOUIFF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine?
The IUPAC name of 2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine (CID 3058776) is 2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine.
What is the SMILES notation for 2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine?
The canonical SMILES for 2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine is CC(C)=CCCC(C)CC1NCCS1.
What is the InChIKey of 2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine?
The InChIKey is OCSCKACVZOUIFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NS/c1-10(2)5-4-6-11(3)9-12-13-7-8-14-12/h5,11-13H,4,6-9H2,1-3H3.
What are the key properties of 2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine?
2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine has a molecular weight of 213.39 g/mol, XLogP of 3.42, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylhept-5-enyl)-1,3-thiazolidine is sourced from PubChem (CID 3058776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).