C8H13NS — CID 3058779
2-but-3-ynyl-2-methyl-1,3-thiazolidine (PubChem CID 3058779) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 2-but-3-ynyl-2-methyl-1,3-thiazolidine.
| Compound Name | 2-but-3-ynyl-2-methyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 3058779 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 2-but-3-ynyl-2-methyl-1,3-thiazolidine |
| SMILES | C#CCCC1(C)NCCS1 |
| InChI | InChI=1S/C8H13NS/c1-3-4-5-8(2)9-6-7-10-8/h1,9H,4-7H2,2H3 |
| InChIKey | FXRNBPCZRLQJDN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|