About 2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline
2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline (PubChem CID 30589) has the molecular formula C22H28N2O4
and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline.
Molecular Properties
| Compound Name | 2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline |
| PubChem CID | 30589 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline |
| SMILES | O=C([O-])C(=O)O.c1ccc(-c2ccccc2NCCCC[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C20H26N2.C2H2O4/c1-2-10-18(11-3-1)19-12-4-5-13-20(19)21-14-6-7-15-22-16-8-9-17-22;3-1(4)2(5)6/h1-5,10-13,21H,6-9,14-17H2;(H,3,4)(H,5,6) |
| InChIKey | UDLHCPNEXFUCMM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline?
The IUPAC name of 2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline (CID 30589) is 2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline.
What is the SMILES notation for 2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline?
The canonical SMILES for 2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline is O=C([O-])C(=O)O.c1ccc(-c2ccccc2NCCCC[NH+]2CCCC2)cc1.
What is the InChIKey of 2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline?
The InChIKey is UDLHCPNEXFUCMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2.C2H2O4/c1-2-10-18(11-3-1)19-12-4-5-13-20(19)21-14-6-7-15-22-16-8-9-17-22;3-1(4)2(5)6/h1-5,10-13,21H,6-9,14-17H2;(H,3,4)(H,5,6).
What are the key properties of 2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline?
2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline has a molecular weight of 384.48 g/mol, XLogP of 1.05, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-oxoacetate;2-phenyl-N-(4-pyrrolidin-1-ium-1-ylbutyl)aniline is sourced from PubChem (CID 30589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).