C16H13N3O2 — CID 3059094
1-phenyl-14,15-dioxa-3,8,10-triazatetracyclo[10.2.1.02,10.04,9]pentadeca-2,4(9),5,7-tetraene (PubChem CID 3059094) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 1-phenyl-14,15-dioxa-3,8,10-triazatetracyclo[10.2.1.02,10.04,9]pentadeca-2,4(9),5,7-tetraene.
| Compound Name | 1-phenyl-14,15-dioxa-3,8,10-triazatetracyclo[10.2.1.02,10.04,9]pentadeca-2,4(9),5,7-tetraene |
|---|---|
| PubChem CID | 3059094 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-phenyl-14,15-dioxa-3,8,10-triazatetracyclo[10.2.1.02,10.04,9]pentadeca-2,4(9),5,7-tetraene |
| SMILES | c1ccc(C23OCC(Cn4c2nc2cccnc24)O3)cc1 |
| InChI | InChI=1S/C16H13N3O2/c1-2-5-11(6-3-1)16-15-18-13-7-4-8-17-14(13)19(15)9-12(21-16)10-20-16/h1-8,12H,9-10H2 |
| InChIKey | HZVHYKXOLHJINT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |