C12H28N4 — CID 3059283
1,4,7,10-tetramethyl-1,4,7,10-tetrazacyclododecane (PubChem CID 3059283) has the molecular formula C12H28N4 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1,4,7,10-tetramethyl-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,4,7,10-tetramethyl-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 3059283 |
| Molecular Formula | C12H28N4 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | 1,4,7,10-tetramethyl-1,4,7,10-tetrazacyclododecane |
| SMILES | CN1CCN(C)CCN(C)CCN(C)CC1 |
| InChI | InChI=1S/C12H28N4/c1-13-5-7-14(2)9-11-16(4)12-10-15(3)8-6-13/h5-12H2,1-4H3 |
| InChIKey | STYFDKOQURBOGQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |