C14H14N2O2 — CID 3059294
2-[4-(pyridin-2-ylamino)phenyl]propanoic acid (PubChem CID 3059294) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-[4-(pyridin-2-ylamino)phenyl]propanoic acid.
| Compound Name | 2-[4-(pyridin-2-ylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 3059294 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-[4-(pyridin-2-ylamino)phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(Nc2ccccn2)cc1 |
| InChI | InChI=1S/C14H14N2O2/c1-10(14(17)18)11-5-7-12(8-6-11)16-13-4-2-3-9-15-13/h2-10H,1H3,(H,15,16)(H,17,18) |
| InChIKey | AHBKHOGVLKUYAT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |