C17H19Cl2F3N2O4S — CID 3059439
(S)-[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-[(2S)-piperidin-2-yl]methanol;methanesulfonic acid (PubChem CID 3059439) has the molecular formula C17H19Cl2F3N2O4S and a molecular weight of 475.32 g/mol. Its IUPAC name is (S)-[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-[(2S)-piperidin-2-yl]methanol;methanesulfonic acid.
| Compound Name | (S)-[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-[(2S)-piperidin-2-yl]methanol;methanesulfonic acid |
|---|---|
| PubChem CID | 3059439 |
| Molecular Formula | C17H19Cl2F3N2O4S |
| Molecular Weight | 475.32 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | (S)-[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-[(2S)-piperidin-2-yl]methanol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O[C@@H](c1cc(C(F)(F)F)nc2c(Cl)cc(Cl)cc12)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C16H15Cl2F3N2O.CH4O3S/c17-8-5-9-10(15(24)12-3-1-2-4-22-12)7-13(16(19,20)21)23-14(9)11(18)6-8;1-5(2,3)4/h5-7,12,15,22,24H,1-4H2;1H3,(H,2,3,4)/t12-,15-;/m0./s1 |
| InChIKey | BKVZXESTLGCNPZ-NXCSSKFKSA-N |
| XLogP | 4.24 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|