C14H12N4O — CID 3059461
1-(3-phenyl-2H-pyrido[3,4-e][1,2,4]triazin-1-yl)ethanone (PubChem CID 3059461) has the molecular formula C14H12N4O and a molecular weight of 252.28 g/mol. Its IUPAC name is 1-(3-phenyl-2H-pyrido[3,4-e][1,2,4]triazin-1-yl)ethanone.
| Compound Name | 1-(3-phenyl-2H-pyrido[3,4-e][1,2,4]triazin-1-yl)ethanone |
|---|---|
| PubChem CID | 3059461 |
| Molecular Formula | C14H12N4O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 1-(3-phenyl-2H-pyrido[3,4-e][1,2,4]triazin-1-yl)ethanone |
| SMILES | CC(=O)N1NC(c2ccccc2)=Nc2cnccc21 |
| InChI | InChI=1S/C14H12N4O/c1-10(19)18-13-7-8-15-9-12(13)16-14(17-18)11-5-3-2-4-6-11/h2-9H,1H3,(H,16,17) |
| InChIKey | GRXARNNAJDGLND-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |