C16H19ClN2O3 — CID 3059521
ethyl 3-oxo-6-phenyl-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridine-2-carboxylate;hydrochloride (PubChem CID 3059521) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is ethyl 3-oxo-6-phenyl-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridine-2-carboxylate;hydrochloride.
| Compound Name | ethyl 3-oxo-6-phenyl-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 3059521 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | ethyl 3-oxo-6-phenyl-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridine-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1N=C2CCC(c3ccccc3)CN2C1=O.Cl |
| InChI | InChI=1S/C16H18N2O3.ClH/c1-2-21-16(20)14-15(19)18-10-12(8-9-13(18)17-14)11-6-4-3-5-7-11;/h3-7,12,14H,2,8-10H2,1H3;1H |
| InChIKey | GCTGHJNWULONBU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|