C17H23NO4 — CID 3059557
oxalic acid;9-propyl-9-azatricyclo[6.4.1.02,7]trideca-2,4,6-triene (PubChem CID 3059557) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is oxalic acid;9-propyl-9-azatricyclo[6.4.1.02,7]trideca-2,4,6-triene.
| Compound Name | oxalic acid;9-propyl-9-azatricyclo[6.4.1.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 3059557 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | oxalic acid;9-propyl-9-azatricyclo[6.4.1.02,7]trideca-2,4,6-triene |
| SMILES | CCCN1CCCC2CC1c1ccccc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H21N.C2H2O4/c1-2-9-16-10-5-6-12-11-15(16)14-8-4-3-7-13(12)14;3-1(4)2(5)6/h3-4,7-8,12,15H,2,5-6,9-11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | XEAZKBNLLOJHAJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|