C12H15N3O4 — CID 30595645
N-(2-acetamidoethyl)-4-methyl-3-nitrobenzamide (PubChem CID 30595645) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-4-methyl-3-nitrobenzamide.
| Compound Name | N-(2-acetamidoethyl)-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 30595645 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-(2-acetamidoethyl)-4-methyl-3-nitrobenzamide |
| SMILES | CC(=O)NCCNC(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15N3O4/c1-8-3-4-10(7-11(8)15(18)19)12(17)14-6-5-13-9(2)16/h3-4,7H,5-6H2,1-2H3,(H,13,16)(H,14,17) |
| InChIKey | UHVHWKXDLSRBSV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|