C17H15BrN2S — CID 3059702
2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrobromide (PubChem CID 3059702) has the molecular formula C17H15BrN2S and a molecular weight of 359.29 g/mol. Its IUPAC name is 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrobromide.
| Compound Name | 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrobromide |
|---|---|
| PubChem CID | 3059702 |
| Molecular Formula | C17H15BrN2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;hydrobromide |
| SMILES | Br.c1ccc(C2=C(c3ccccc3)N3CCN=C3S2)cc1 |
| InChI | InChI=1S/C17H14N2S.BrH/c1-3-7-13(8-4-1)15-16(14-9-5-2-6-10-14)20-17-18-11-12-19(15)17;/h1-10H,11-12H2;1H |
| InChIKey | JAEDJTUWINYJNF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|