C15H23N3O4 — CID 30597236
propan-2-yl 5-(2-acetamidoethylcarbamoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 30597236) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is propan-2-yl 5-(2-acetamidoethylcarbamoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | propan-2-yl 5-(2-acetamidoethylcarbamoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 30597236 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | propan-2-yl 5-(2-acetamidoethylcarbamoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CC(=O)NCCNC(=O)c1[nH]c(C)c(C(=O)OC(C)C)c1C |
| InChI | InChI=1S/C15H23N3O4/c1-8(2)22-15(21)12-9(3)13(18-10(12)4)14(20)17-7-6-16-11(5)19/h8,18H,6-7H2,1-5H3,(H,16,19)(H,17,20) |
| InChIKey | RNSAZCJUJGYLDH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|