C19H25N3O2 — CID 30597510
3-[[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 30597510) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-[[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 30597510 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 3-[[[(1S)-2,3-dihydro-1H-inden-1-yl]-methylamino]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CN(CN1C(=O)NC2(CCCCC2)C1=O)[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C19H25N3O2/c1-21(16-10-9-14-7-3-4-8-15(14)16)13-22-17(23)19(20-18(22)24)11-5-2-6-12-19/h3-4,7-8,16H,2,5-6,9-13H2,1H3,(H,20,24)/t16-/m0/s1 |
| InChIKey | XRMJRGPJYFLGJN-INIZCTEOSA-N |
| XLogP | 2.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|