C11H11ClN2O2 — CID 3059888
1-(4-chlorophenyl)-3-methyl-1,3-diazinane-2,4-dione (PubChem CID 3059888) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 1-(4-chlorophenyl)-3-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 3059888 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3-methyl-1,3-diazinane-2,4-dione |
| SMILES | CN1C(=O)CCN(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C11H11ClN2O2/c1-13-10(15)6-7-14(11(13)16)9-4-2-8(12)3-5-9/h2-5H,6-7H2,1H3 |
| InChIKey | OOAAGWMBSXRCET-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |