C16H15BrN6O4 — CID 30599169
N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carbohydrazide (PubChem CID 30599169) has the molecular formula C16H15BrN6O4 and a molecular weight of 435.24 g/mol. Its IUPAC name is N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carbohydrazide.
| Compound Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 30599169 |
| Molecular Formula | C16H15BrN6O4 |
| Molecular Weight | 435.24 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carbohydrazide |
| SMILES | Cn1cc(Br)cc1C(=O)NNC(=O)c1cnc2c(c1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H15BrN6O4/c1-21-7-9(17)5-11(21)14(25)20-19-13(24)8-4-10-12(18-6-8)22(2)16(27)23(3)15(10)26/h4-7H,1-3H3,(H,19,24)(H,20,25) |
| InChIKey | KKDUAAGCVOKAGV-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|