C13H15NS — CID 3059924
(3aR,7aS)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole (PubChem CID 3059924) has the molecular formula C13H15NS and a molecular weight of 217.34 g/mol. Its IUPAC name is (3aR,7aS)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole.
| Compound Name | (3aR,7aS)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 3059924 |
| Molecular Formula | C13H15NS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | (3aR,7aS)-2-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole |
| SMILES | c1ccc(C2=N[C@@H]3CCCC[C@@H]3S2)cc1 |
| InChI | InChI=1S/C13H15NS/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h1-3,6-7,11-12H,4-5,8-9H2/t11-,12+/m1/s1 |
| InChIKey | SFRQTBQMIUARDJ-NEPJUHHUSA-N |
| XLogP | 3.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |